C27H27ClN2O4S — CID 18901971
N-(5-chloro-2,4-dimethoxyphenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylbutanamide (PubChem CID 18901971) has the molecular formula C27H27ClN2O4S and a molecular weight of 511.04 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylbutanamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 18901971 |
| Molecular Formula | C27H27ClN2O4S |
| Molecular Weight | 511.04 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C=C/c2ccccc2)c1)C(=O)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C27H27ClN2O4S/c1-4-25(27(32)30-22-16-21(28)23(33-2)17-24(22)34-3)35-20-12-8-11-19(15-20)29-26(31)14-13-18-9-6-5-7-10-18/h5-17,25H,4H2,1-3H3,(H,29,31)(H,30,32)/b14-13+ |
| InChIKey | QTSPXHCNCBVGEV-BUHFOSPRSA-N |
| XLogP | 6.52 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.04 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|