C25H23ClN2O2S — CID 18901944
N-(2-chlorophenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylbutanamide (PubChem CID 18901944) has the molecular formula C25H23ClN2O2S and a molecular weight of 450.99 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylbutanamide.
| Compound Name | N-(2-chlorophenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 18901944 |
| Molecular Formula | C25H23ClN2O2S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-(2-chlorophenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C=C/c2ccccc2)c1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C25H23ClN2O2S/c1-2-23(25(30)28-22-14-7-6-13-21(22)26)31-20-12-8-11-19(17-20)27-24(29)16-15-18-9-4-3-5-10-18/h3-17,23H,2H2,1H3,(H,27,29)(H,28,30)/b16-15+ |
| InChIKey | FIBGXKCWOZETQB-FOCLMDBBSA-N |
| XLogP | 6.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|