C23H18Cl2N2O2S — CID 18901879
(E)-N-[3-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 18901879) has the molecular formula C23H18Cl2N2O2S and a molecular weight of 457.38 g/mol. Its IUPAC name is (E)-N-[3-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18901879 |
| Molecular Formula | C23H18Cl2N2O2S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | (E)-N-[3-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1cccc(SCC(=O)Nc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C23H18Cl2N2O2S/c24-19-10-5-11-20(23(19)25)27-22(29)15-30-18-9-4-8-17(14-18)26-21(28)13-12-16-6-2-1-3-7-16/h1-14H,15H2,(H,26,28)(H,27,29)/b13-12+ |
| InChIKey | HSLLYTBNRBUSTP-OUKQBFOZSA-N |
| XLogP | 6.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|