C23H17Cl2NO2S — CID 19299446
(E)-N-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 19299446) has the molecular formula C23H17Cl2NO2S and a molecular weight of 442.37 g/mol. Its IUPAC name is (E)-N-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 19299446 |
| Molecular Formula | C23H17Cl2NO2S |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | (E)-N-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1cccc(SCC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C23H17Cl2NO2S/c24-17-10-11-20(21(25)13-17)22(27)15-29-19-8-4-7-18(14-19)26-23(28)12-9-16-5-2-1-3-6-16/h1-14H,15H2,(H,26,28)/b12-9+ |
| InChIKey | QQPKLCFGXVBAML-FMIVXFBMSA-N |
| XLogP | 6.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|