C16H13Cl2NO2S — CID 19299392
N-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]acetamide (PubChem CID 19299392) has the molecular formula C16H13Cl2NO2S and a molecular weight of 354.26 g/mol. Its IUPAC name is N-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]acetamide.
| Compound Name | N-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 19299392 |
| Molecular Formula | C16H13Cl2NO2S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | N-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(SCC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO2S/c1-10(20)19-12-3-2-4-13(8-12)22-9-16(21)14-6-5-11(17)7-15(14)18/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | ILXZTEYZDWCQEX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |