C19H20ClNO2S — CID 19299517
N-[3-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]pentanamide (PubChem CID 19299517) has the molecular formula C19H20ClNO2S and a molecular weight of 361.89 g/mol. Its IUPAC name is N-[3-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]pentanamide.
| Compound Name | N-[3-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 19299517 |
| Molecular Formula | C19H20ClNO2S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[3-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(SCC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H20ClNO2S/c1-2-3-11-19(23)21-14-7-6-8-15(12-14)24-13-18(22)16-9-4-5-10-17(16)20/h4-10,12H,2-3,11,13H2,1H3,(H,21,23) |
| InChIKey | WLJIZZNGRWJCPS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |