C21H26N2O2S — CID 18903036
N-[3-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanylphenyl]pentanamide (PubChem CID 18903036) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is N-[3-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanylphenyl]pentanamide.
| Compound Name | N-[3-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 18903036 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[3-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(SCC(=O)Nc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-4-5-12-20(24)22-17-9-7-10-18(13-17)26-14-21(25)23-19-11-6-8-15(2)16(19)3/h6-11,13H,4-5,12,14H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | UTPRRAXBUDFZTH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |