C23H19FN2O2S — CID 18901911
(E)-N-[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 18901911) has the molecular formula C23H19FN2O2S and a molecular weight of 406.48 g/mol. Its IUPAC name is (E)-N-[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18901911 |
| Molecular Formula | C23H19FN2O2S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (E)-N-[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1cccc(SCC(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H19FN2O2S/c24-18-10-12-19(13-11-18)25-23(28)16-29-21-8-4-7-20(15-21)26-22(27)14-9-17-5-2-1-3-6-17/h1-15H,16H2,(H,25,28)(H,26,27)/b14-9+ |
| InChIKey | GTQIDVRNVIXKBM-NTEUORMPSA-N |
| XLogP | 5.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|