C27H21FN2O3S — CID 18904222
4-fluoro-N-[3-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylphenyl]benzamide (PubChem CID 18904222) has the molecular formula C27H21FN2O3S and a molecular weight of 472.54 g/mol. Its IUPAC name is 4-fluoro-N-[3-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18904222 |
| Molecular Formula | C27H21FN2O3S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 4-fluoro-N-[3-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)c2ccc(F)cc2)c1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H21FN2O3S/c28-20-11-9-19(10-12-20)27(32)30-22-5-4-8-25(17-22)34-18-26(31)29-21-13-15-24(16-14-21)33-23-6-2-1-3-7-23/h1-17H,18H2,(H,29,31)(H,30,32) |
| InChIKey | CVIVHHHTUOLLLV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |