C27H22N2O4 — CID 18870214
N-[3-[2-oxo-2-(4-phenoxyanilino)ethoxy]phenyl]benzamide (PubChem CID 18870214) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[3-[2-oxo-2-(4-phenoxyanilino)ethoxy]phenyl]benzamide.
| Compound Name | N-[3-[2-oxo-2-(4-phenoxyanilino)ethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 18870214 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[3-[2-oxo-2-(4-phenoxyanilino)ethoxy]phenyl]benzamide |
| SMILES | O=C(COc1cccc(NC(=O)c2ccccc2)c1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N2O4/c30-26(28-21-14-16-24(17-15-21)33-23-11-5-2-6-12-23)19-32-25-13-7-10-22(18-25)29-27(31)20-8-3-1-4-9-20/h1-18H,19H2,(H,28,30)(H,29,31) |
| InChIKey | KMVGMXZBFIMGNJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |