C22H17F3N2O5S — CID 55902221
N-[3-(2-anilino-2-oxoethoxy)phenyl]-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 55902221) has the molecular formula C22H17F3N2O5S and a molecular weight of 478.45 g/mol. Its IUPAC name is N-[3-(2-anilino-2-oxoethoxy)phenyl]-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-[3-(2-anilino-2-oxoethoxy)phenyl]-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 55902221 |
| Molecular Formula | C22H17F3N2O5S |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | N-[3-(2-anilino-2-oxoethoxy)phenyl]-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | O=C(COc1cccc(NC(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)c1)Nc1ccccc1 |
| InChI | InChI=1S/C22H17F3N2O5S/c23-22(24,25)33(30,31)19-11-9-15(10-12-19)21(29)27-17-7-4-8-18(13-17)32-14-20(28)26-16-5-2-1-3-6-16/h1-13H,14H2,(H,26,28)(H,27,29) |
| InChIKey | ACWJDEQTALAVDG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |