C14H10F3NO3S — CID 58602789
N-[3-(trifluoromethylsulfonyl)phenyl]benzamide (PubChem CID 58602789) has the molecular formula C14H10F3NO3S and a molecular weight of 329.30 g/mol. Its IUPAC name is N-[3-(trifluoromethylsulfonyl)phenyl]benzamide.
| Compound Name | N-[3-(trifluoromethylsulfonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58602789 |
| Molecular Formula | C14H10F3NO3S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-[3-(trifluoromethylsulfonyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C14H10F3NO3S/c15-14(16,17)22(20,21)12-8-4-7-11(9-12)18-13(19)10-5-2-1-3-6-10/h1-9H,(H,18,19) |
| InChIKey | DPKLPTNEXSNYOB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |