C20H15F3N2O5S2 — CID 166636313
2-(benzenesulfonamido)-N-phenyl-5-(trifluoromethylsulfonyl)benzamide (PubChem CID 166636313) has the molecular formula C20H15F3N2O5S2 and a molecular weight of 484.48 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-phenyl-5-(trifluoromethylsulfonyl)benzamide.
| Compound Name | 2-(benzenesulfonamido)-N-phenyl-5-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 166636313 |
| Molecular Formula | C20H15F3N2O5S2 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 2-(benzenesulfonamido)-N-phenyl-5-(trifluoromethylsulfonyl)benzamide |
| SMILES | O=C(Nc1ccccc1)c1cc(S(=O)(=O)C(F)(F)F)ccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H15F3N2O5S2/c21-20(22,23)31(27,28)16-11-12-18(25-32(29,30)15-9-5-2-6-10-15)17(13-16)19(26)24-14-7-3-1-4-8-14/h1-13,25H,(H,24,26) |
| InChIKey | OPTZSUVFWNVURK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |