C15H14N2O8S2 — CID 3753672
2-[(4-acetamidophenyl)sulfonylamino]-5-sulfobenzoic acid (PubChem CID 3753672) has the molecular formula C15H14N2O8S2 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonylamino]-5-sulfobenzoic acid.
| Compound Name | 2-[(4-acetamidophenyl)sulfonylamino]-5-sulfobenzoic acid |
|---|---|
| PubChem CID | 3753672 |
| Molecular Formula | C15H14N2O8S2 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonylamino]-5-sulfobenzoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)O)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C15H14N2O8S2/c1-9(18)16-10-2-4-11(5-3-10)26(21,22)17-14-7-6-12(27(23,24)25)8-13(14)15(19)20/h2-8,17H,1H3,(H,16,18)(H,19,20)(H,23,24,25) |
| InChIKey | JLCPQHXCWCDUFZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|