C15H14N2O5S — CID 3863821
2-[(4-acetamidophenyl)sulfonylamino]benzoic acid (PubChem CID 3863821) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[(4-acetamidophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 3863821 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonylamino]benzoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C15H14N2O5S/c1-10(18)16-11-6-8-12(9-7-11)23(21,22)17-14-5-3-2-4-13(14)15(19)20/h2-9,17H,1H3,(H,16,18)(H,19,20) |
| InChIKey | PLPHKOWBVINJBY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |