C15H15N3O7S2 — CID 123662149
1-[(4-acetamidophenyl)sulfonylamino]-2-(sulfinoamino)oxycarbonylbenzene (PubChem CID 123662149) has the molecular formula C15H15N3O7S2 and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[(4-acetamidophenyl)sulfonylamino]-2-(sulfinoamino)oxycarbonylbenzene.
| Compound Name | 1-[(4-acetamidophenyl)sulfonylamino]-2-(sulfinoamino)oxycarbonylbenzene |
|---|---|
| PubChem CID | 123662149 |
| Molecular Formula | C15H15N3O7S2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 1-[(4-acetamidophenyl)sulfonylamino]-2-(sulfinoamino)oxycarbonylbenzene |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2C(=O)ONS(=O)O)cc1 |
| InChI | InChI=1S/C15H15N3O7S2/c1-10(19)16-11-6-8-12(9-7-11)27(23,24)17-14-5-3-2-4-13(14)15(20)25-18-26(21)22/h2-9,17-18H,1H3,(H,16,19)(H,21,22) |
| InChIKey | VICISSOLLSRPIM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|