C17H20N2O4S — CID 110776847
N-[4-[(2-methoxy-4,5-dimethylphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 110776847) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[4-[(2-methoxy-4,5-dimethylphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(2-methoxy-4,5-dimethylphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 110776847 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[4-[(2-methoxy-4,5-dimethylphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1cc(C)c(C)cc1NS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-11-9-16(17(23-4)10-12(11)2)19-24(21,22)15-7-5-14(6-8-15)18-13(3)20/h5-10,19H,1-4H3,(H,18,20) |
| InChIKey | AWJUQTKZDFGEQR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |