C17H20N4O5S — CID 2205372
N-[4-[[(2-methoxy-5-methylphenyl)carbamoylamino]sulfamoyl]phenyl]acetamide (PubChem CID 2205372) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-[4-[[(2-methoxy-5-methylphenyl)carbamoylamino]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(2-methoxy-5-methylphenyl)carbamoylamino]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2205372 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[4-[[(2-methoxy-5-methylphenyl)carbamoylamino]sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)NNS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C17H20N4O5S/c1-11-4-9-16(26-3)15(10-11)19-17(23)20-21-27(24,25)14-7-5-13(6-8-14)18-12(2)22/h4-10,21H,1-3H3,(H,18,22)(H2,19,20,23) |
| InChIKey | NQNYKRCVAKVKKG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|