C16H19N3O3S2 — CID 19680097
1-(2-methoxy-5-methylphenyl)-3-[4-(methylsulfamoyl)phenyl]thiourea (PubChem CID 19680097) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-[4-(methylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-[4-(methylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19680097 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-[4-(methylsulfamoyl)phenyl]thiourea |
| SMILES | CNS(=O)(=O)c1ccc(NC(=S)Nc2cc(C)ccc2OC)cc1 |
| InChI | InChI=1S/C16H19N3O3S2/c1-11-4-9-15(22-3)14(10-11)19-16(23)18-12-5-7-13(8-6-12)24(20,21)17-2/h4-10,17H,1-3H3,(H2,18,19,23) |
| InChIKey | PZUUJKIUMSAGOI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|