C20H22N2O7S — CID 168569731
dimethyl (E)-2-[4-[(2-methoxy-5-methylphenyl)sulfamoyl]anilino]but-2-enedioate (PubChem CID 168569731) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[(2-methoxy-5-methylphenyl)sulfamoyl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[(2-methoxy-5-methylphenyl)sulfamoyl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569731 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | dimethyl (E)-2-[4-[(2-methoxy-5-methylphenyl)sulfamoyl]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(S(=O)(=O)Nc2cc(C)ccc2OC)cc1)C(=O)OC |
| InChI | InChI=1S/C20H22N2O7S/c1-13-5-10-18(27-2)16(11-13)22-30(25,26)15-8-6-14(7-9-15)21-17(20(24)29-4)12-19(23)28-3/h5-12,21-22H,1-4H3/b17-12+ |
| InChIKey | ZYQWKULALLCNEU-SFQUDFHCSA-N |
| XLogP | 2.45 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|