C20H22N2O6S — CID 168569316
dimethyl (E)-2-[4-[(2,5-dimethylphenyl)sulfamoyl]anilino]but-2-enedioate (PubChem CID 168569316) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[(2,5-dimethylphenyl)sulfamoyl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[(2,5-dimethylphenyl)sulfamoyl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569316 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | dimethyl (E)-2-[4-[(2,5-dimethylphenyl)sulfamoyl]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(S(=O)(=O)Nc2cc(C)ccc2C)cc1)C(=O)OC |
| InChI | InChI=1S/C20H22N2O6S/c1-13-5-6-14(2)17(11-13)22-29(25,26)16-9-7-15(8-10-16)21-18(20(24)28-4)12-19(23)27-3/h5-12,21-22H,1-4H3/b18-12+ |
| InChIKey | RXBXYACCCYDAEZ-LDADJPATSA-N |
| XLogP | 2.75 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|