C17H18BrNO4S — CID 24762558
5-bromo-2-[(4-tert-butylphenyl)sulfonylamino]benzoic acid (PubChem CID 24762558) has the molecular formula C17H18BrNO4S and a molecular weight of 412.31 g/mol. Its IUPAC name is 5-bromo-2-[(4-tert-butylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 5-bromo-2-[(4-tert-butylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 24762558 |
| Molecular Formula | C17H18BrNO4S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 5-bromo-2-[(4-tert-butylphenyl)sulfonylamino]benzoic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Br)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C17H18BrNO4S/c1-17(2,3)11-4-7-13(8-5-11)24(22,23)19-15-9-6-12(18)10-14(15)16(20)21/h4-10,19H,1-3H3,(H,20,21) |
| InChIKey | YHTOCPGTKWILTB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |