C17H18NO5S- — CID 54725188
5-[(4-tert-butylphenyl)sulfonylamino]-2-carboxyphenolate (PubChem CID 54725188) has the molecular formula C17H18NO5S- and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfonylamino]-2-carboxyphenolate.
| Compound Name | 5-[(4-tert-butylphenyl)sulfonylamino]-2-carboxyphenolate |
|---|---|
| PubChem CID | 54725188 |
| Molecular Formula | C17H18NO5S- |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfonylamino]-2-carboxyphenolate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(C(=O)O)c([O-])c2)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-17(2,3)11-4-7-13(8-5-11)24(22,23)18-12-6-9-14(16(20)21)15(19)10-12/h4-10,18-19H,1-3H3,(H,20,21)/p-1 |
| InChIKey | SHXVGWWZXXDPJK-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |