C14H12NO6S- — CID 54710152
2-carboxy-4-[(4-methoxyphenyl)sulfonylamino]phenolate (PubChem CID 54710152) has the molecular formula C14H12NO6S- and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-carboxy-4-[(4-methoxyphenyl)sulfonylamino]phenolate.
| Compound Name | 2-carboxy-4-[(4-methoxyphenyl)sulfonylamino]phenolate |
|---|---|
| PubChem CID | 54710152 |
| Molecular Formula | C14H12NO6S- |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-carboxy-4-[(4-methoxyphenyl)sulfonylamino]phenolate |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc([O-])c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C14H13NO6S/c1-21-10-3-5-11(6-4-10)22(19,20)15-9-2-7-13(16)12(8-9)14(17)18/h2-8,15-16H,1H3,(H,17,18)/p-1 |
| InChIKey | MQKVIVPTKIHIAY-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |