C24H31N3O5S — CID 92887967
5-[(4-methoxyphenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid (PubChem CID 92887967) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid.
| Compound Name | 5-[(4-methoxyphenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 92887967 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 5-[(4-methoxyphenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(N3CCC[C@H](CN4CCCC4)C3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-32-20-7-9-21(10-8-20)33(30,31)25-19-6-11-23(22(15-19)24(28)29)27-14-4-5-18(17-27)16-26-12-2-3-13-26/h6-11,15,18,25H,2-5,12-14,16-17H2,1H3,(H,28,29)/t18-/m1/s1 |
| InChIKey | AAUFPEKMDOIUSK-GOSISDBHSA-N |
| XLogP | 3.51 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|