C21H26ClN3O4S2 — CID 46292305
5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid (PubChem CID 46292305) has the molecular formula C21H26ClN3O4S2 and a molecular weight of 484.04 g/mol. Its IUPAC name is 5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid.
| Compound Name | 5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 46292305 |
| Molecular Formula | C21H26ClN3O4S2 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccc(Cl)s2)ccc1N1CCCC(CN2CCCC2)C1 |
| InChI | InChI=1S/C21H26ClN3O4S2/c22-19-7-8-20(30-19)31(28,29)23-16-5-6-18(17(12-16)21(26)27)25-11-3-4-15(14-25)13-24-9-1-2-10-24/h5-8,12,15,23H,1-4,9-11,13-14H2,(H,26,27) |
| InChIKey | VKERHHQDRWLHBO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|