C24H31N3O4S — CID 92887972
5-[(4-methylphenyl)sulfonylamino]-2-[(3S)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid (PubChem CID 92887972) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 5-[(4-methylphenyl)sulfonylamino]-2-[(3S)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid.
| Compound Name | 5-[(4-methylphenyl)sulfonylamino]-2-[(3S)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 92887972 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 5-[(4-methylphenyl)sulfonylamino]-2-[(3S)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCC[C@@H](CN4CCCC4)C3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C24H31N3O4S/c1-18-6-9-21(10-7-18)32(30,31)25-20-8-11-23(22(15-20)24(28)29)27-14-4-5-19(17-27)16-26-12-2-3-13-26/h6-11,15,19,25H,2-5,12-14,16-17H2,1H3,(H,28,29)/t19-/m0/s1 |
| InChIKey | KXGCTOKUELIDDY-IBGZPJMESA-N |
| XLogP | 3.81 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|