C27H34F3N3O6S — CID 146055497
5-[(4-ethylphenyl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055497) has the molecular formula C27H34F3N3O6S and a molecular weight of 585.65 g/mol. Its IUPAC name is 5-[(4-ethylphenyl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(4-ethylphenyl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055497 |
| Molecular Formula | C27H34F3N3O6S |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 5-[(4-ethylphenyl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(N3CCCC(CN4CCCC4)C3)c(C(=O)O)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H33N3O4S.C2HF3O2/c1-2-19-7-10-22(11-8-19)33(31,32)26-21-9-12-24(23(16-21)25(29)30)28-15-5-6-20(18-28)17-27-13-3-4-14-27;3-2(4,5)1(6)7/h7-12,16,20,26H,2-6,13-15,17-18H2,1H3,(H,29,30);(H,6,7) |
| InChIKey | AUJSYSQTEFYBEI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|