C21H30F3N3O6S — CID 146055487
5-(ethylsulfonylamino)-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055487) has the molecular formula C21H30F3N3O6S and a molecular weight of 509.55 g/mol. Its IUPAC name is 5-(ethylsulfonylamino)-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(ethylsulfonylamino)-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055487 |
| Molecular Formula | C21H30F3N3O6S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 5-(ethylsulfonylamino)-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)Nc1ccc(N2CCCC(CN3CCCC3)C2)c(C(=O)O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H29N3O4S.C2HF3O2/c1-2-27(25,26)20-16-7-8-18(17(12-16)19(23)24)22-11-5-6-15(14-22)13-21-9-3-4-10-21;3-2(4,5)1(6)7/h7-8,12,15,20H,2-6,9-11,13-14H2,1H3,(H,23,24);(H,6,7) |
| InChIKey | POUZSXKYEDXYEQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|