C27H37N3O4S — CID 50766893
5-[(4-tert-butylphenyl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid (PubChem CID 50766893) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid.
| Compound Name | 5-[(4-tert-butylphenyl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50766893 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfonylamino]-2-[3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(N3CCCC(CN4CCCC4)C3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H37N3O4S/c1-27(2,3)21-8-11-23(12-9-21)35(33,34)28-22-10-13-25(24(17-22)26(31)32)30-16-6-7-20(19-30)18-29-14-4-5-15-29/h8-13,17,20,28H,4-7,14-16,18-19H2,1-3H3,(H,31,32) |
| InChIKey | SJGAMVBQBORROV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|