C23H28ClN3O4S — CID 92887995
5-[(2-chlorophenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid (PubChem CID 92887995) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid.
| Compound Name | 5-[(2-chlorophenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 92887995 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 5-[(2-chlorophenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccccc2Cl)ccc1N1CCC[C@H](CN2CCCC2)C1 |
| InChI | InChI=1S/C23H28ClN3O4S/c24-20-7-1-2-8-22(20)32(30,31)25-18-9-10-21(19(14-18)23(28)29)27-13-5-6-17(16-27)15-26-11-3-4-12-26/h1-2,7-10,14,17,25H,3-6,11-13,15-16H2,(H,28,29)/t17-/m1/s1 |
| InChIKey | BHPISPXTEVWLMU-QGZVFWFLSA-N |
| XLogP | 4.15 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|