C24H30FN3O4S — CID 92887999
5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid (PubChem CID 92887999) has the molecular formula C24H30FN3O4S and a molecular weight of 475.59 g/mol. Its IUPAC name is 5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid.
| Compound Name | 5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 92887999 |
| Molecular Formula | C24H30FN3O4S |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[(3R)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)Nc1ccc(N2CCC[C@H](CN3CCCC3)C2)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H30FN3O4S/c1-17-6-7-19(25)13-23(17)33(31,32)26-20-8-9-22(21(14-20)24(29)30)28-12-4-5-18(16-28)15-27-10-2-3-11-27/h6-9,13-14,18,26H,2-5,10-12,15-16H2,1H3,(H,29,30)/t18-/m1/s1 |
| InChIKey | OGFJKGLXBRCXDD-GOSISDBHSA-N |
| XLogP | 3.95 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|