C21H25FN2O4S — CID 46292221
2-(azocan-1-yl)-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 46292221) has the molecular formula C21H25FN2O4S and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-(azocan-1-yl)-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-(azocan-1-yl)-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 46292221 |
| Molecular Formula | C21H25FN2O4S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-(azocan-1-yl)-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)Nc1ccc(N2CCCCCCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H25FN2O4S/c1-15-7-8-16(22)13-20(15)29(27,28)23-17-9-10-19(18(14-17)21(25)26)24-11-5-3-2-4-6-12-24/h7-10,13-14,23H,2-6,11-12H2,1H3,(H,25,26) |
| InChIKey | QBAKZBSKCIWZAQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|