C24H24FN3O4S — CID 50766347
2-[4-(2-fluorophenyl)piperazin-1-yl]-5-[(2-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 50766347) has the molecular formula C24H24FN3O4S and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-5-[(2-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-5-[(2-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766347 |
| Molecular Formula | C24H24FN3O4S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-5-[(2-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1ccc(N2CCN(c3ccccc3F)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H24FN3O4S/c1-17-6-2-5-9-23(17)33(31,32)26-18-10-11-21(19(16-18)24(29)30)27-12-14-28(15-13-27)22-8-4-3-7-20(22)25/h2-11,16,26H,12-15H2,1H3,(H,29,30) |
| InChIKey | NRQCELABHOEIOQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|