C24H32N4O5S — CID 50766196
2-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]-5-[(2-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 50766196) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]-5-[(2-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]-5-[(2-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766196 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]-5-[(2-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | CCCCNC(=O)CN1CCN(c2ccc(NS(=O)(=O)c3ccccc3C)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C24H32N4O5S/c1-3-4-11-25-23(29)17-27-12-14-28(15-13-27)21-10-9-19(16-20(21)24(30)31)26-34(32,33)22-8-6-5-7-18(22)2/h5-10,16,26H,3-4,11-15,17H2,1-2H3,(H,25,29)(H,30,31) |
| InChIKey | OLQKWLUEDPZLMW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|