C19H28N4O4 — CID 46363177
2-[4-[2-oxo-2-(propylamino)ethyl]piperazin-1-yl]-5-(propanoylamino)benzoic acid (PubChem CID 46363177) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[4-[2-oxo-2-(propylamino)ethyl]piperazin-1-yl]-5-(propanoylamino)benzoic acid.
| Compound Name | 2-[4-[2-oxo-2-(propylamino)ethyl]piperazin-1-yl]-5-(propanoylamino)benzoic acid |
|---|---|
| PubChem CID | 46363177 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 2-[4-[2-oxo-2-(propylamino)ethyl]piperazin-1-yl]-5-(propanoylamino)benzoic acid |
| SMILES | CCCNC(=O)CN1CCN(c2ccc(NC(=O)CC)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C19H28N4O4/c1-3-7-20-18(25)13-22-8-10-23(11-9-22)16-6-5-14(21-17(24)4-2)12-15(16)19(26)27/h5-6,12H,3-4,7-11,13H2,1-2H3,(H,20,25)(H,21,24)(H,26,27) |
| InChIKey | JGKJDMVLQFYCHJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|