C21H25FN4O5S — CID 50766240
5-(ethylsulfonylamino)-2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid (PubChem CID 50766240) has the molecular formula C21H25FN4O5S and a molecular weight of 464.52 g/mol. Its IUPAC name is 5-(ethylsulfonylamino)-2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid.
| Compound Name | 5-(ethylsulfonylamino)-2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50766240 |
| Molecular Formula | C21H25FN4O5S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 5-(ethylsulfonylamino)-2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
| SMILES | CCS(=O)(=O)Nc1ccc(N2CCN(CC(=O)Nc3ccc(F)cc3)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H25FN4O5S/c1-2-32(30,31)24-17-7-8-19(18(13-17)21(28)29)26-11-9-25(10-12-26)14-20(27)23-16-5-3-15(22)4-6-16/h3-8,13,24H,2,9-12,14H2,1H3,(H,23,27)(H,28,29) |
| InChIKey | NZDHWWYFLASIBK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|