C28H30N4O4 — CID 46363244
2-[4-[2-(3-methylanilino)-2-oxoethyl]piperazin-1-yl]-5-[(3-methylbenzoyl)amino]benzoic acid (PubChem CID 46363244) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-[4-[2-(3-methylanilino)-2-oxoethyl]piperazin-1-yl]-5-[(3-methylbenzoyl)amino]benzoic acid.
| Compound Name | 2-[4-[2-(3-methylanilino)-2-oxoethyl]piperazin-1-yl]-5-[(3-methylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 46363244 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 2-[4-[2-(3-methylanilino)-2-oxoethyl]piperazin-1-yl]-5-[(3-methylbenzoyl)amino]benzoic acid |
| SMILES | Cc1cccc(NC(=O)CN2CCN(c3ccc(NC(=O)c4cccc(C)c4)cc3C(=O)O)CC2)c1 |
| InChI | InChI=1S/C28H30N4O4/c1-19-5-3-7-21(15-19)27(34)30-23-9-10-25(24(17-23)28(35)36)32-13-11-31(12-14-32)18-26(33)29-22-8-4-6-20(2)16-22/h3-10,15-17H,11-14,18H2,1-2H3,(H,29,33)(H,30,34)(H,35,36) |
| InChIKey | VKMJQFTXGZJMJJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|