C24H28N4O5 — CID 46363252
5-benzamido-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]benzoic acid (PubChem CID 46363252) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 5-benzamido-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]benzoic acid.
| Compound Name | 5-benzamido-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 46363252 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-benzamido-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]benzoic acid |
| SMILES | O=C(Nc1ccc(N2CCN(CC(=O)N3CCOCC3)CC2)c(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C24H28N4O5/c29-22(28-12-14-33-15-13-28)17-26-8-10-27(11-9-26)21-7-6-19(16-20(21)24(31)32)25-23(30)18-4-2-1-3-5-18/h1-7,16H,8-15,17H2,(H,25,30)(H,31,32) |
| InChIKey | DDZCHQLAMWABRU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|