C23H28N4O5S — CID 50766256
5-(benzenesulfonamido)-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]benzoic acid (PubChem CID 50766256) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]benzoic acid.
| Compound Name | 5-(benzenesulfonamido)-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50766256 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 5-(benzenesulfonamido)-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccccc2)ccc1N1CCN(CC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C23H28N4O5S/c28-22(27-10-4-5-11-27)17-25-12-14-26(15-13-25)21-9-8-18(16-20(21)23(29)30)24-33(31,32)19-6-2-1-3-7-19/h1-3,6-9,16,24H,4-5,10-15,17H2,(H,29,30) |
| InChIKey | UZBJLYUHXMVECO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|