C23H30N4O6S — CID 50766193
5-(benzenesulfonamido)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid (PubChem CID 50766193) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid.
| Compound Name | 5-(benzenesulfonamido)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50766193 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 5-(benzenesulfonamido)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
| SMILES | COCCCNC(=O)CN1CCN(c2ccc(NS(=O)(=O)c3ccccc3)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C23H30N4O6S/c1-33-15-5-10-24-22(28)17-26-11-13-27(14-12-26)21-9-8-18(16-20(21)23(29)30)25-34(31,32)19-6-3-2-4-7-19/h2-4,6-9,16,25H,5,10-15,17H2,1H3,(H,24,28)(H,29,30) |
| InChIKey | FNNILCBQJKKOSE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|