C25H31F3N4O8S — CID 146054236
3-(benzenesulfonamido)-4-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146054236) has the molecular formula C25H31F3N4O8S and a molecular weight of 604.60 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-4-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(benzenesulfonamido)-4-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146054236 |
| Molecular Formula | C25H31F3N4O8S |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | 3-(benzenesulfonamido)-4-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COCCCNC(=O)CN1CCN(c2ccc(C(=O)O)cc2NS(=O)(=O)c2ccccc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H30N4O6S.C2HF3O2/c1-33-15-5-10-24-22(28)17-26-11-13-27(14-12-26)21-9-8-18(23(29)30)16-20(21)25-34(31,32)19-6-3-2-4-7-19;3-2(4,5)1(6)7/h2-4,6-9,16,25H,5,10-15,17H2,1H3,(H,24,28)(H,29,30);(H,6,7) |
| InChIKey | JSDDOJRDIJDKRS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|