C20H29F3N4O7S — CID 146054218
4-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]-3-(methanesulfonamido)benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146054218) has the molecular formula C20H29F3N4O7S and a molecular weight of 526.53 g/mol. Its IUPAC name is 4-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]-3-(methanesulfonamido)benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]-3-(methanesulfonamido)benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146054218 |
| Molecular Formula | C20H29F3N4O7S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 4-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]-3-(methanesulfonamido)benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)CN1CCN(c2ccc(C(=O)O)cc2NS(C)(=O)=O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4O5S.C2HF3O2/c1-3-4-7-19-17(23)13-21-8-10-22(11-9-21)16-6-5-14(18(24)25)12-15(16)20-28(2,26)27;3-2(4,5)1(6)7/h5-6,12,20H,3-4,7-11,13H2,1-2H3,(H,19,23)(H,24,25);(H,6,7) |
| InChIKey | RMNCEHGEEVLQQW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|