C24H30N4O4 — CID 46285225
3-[(4-methylbenzoyl)amino]-4-[4-[2-oxo-2-(propylamino)ethyl]piperazin-1-yl]benzoic acid (PubChem CID 46285225) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-[(4-methylbenzoyl)amino]-4-[4-[2-oxo-2-(propylamino)ethyl]piperazin-1-yl]benzoic acid.
| Compound Name | 3-[(4-methylbenzoyl)amino]-4-[4-[2-oxo-2-(propylamino)ethyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 46285225 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 3-[(4-methylbenzoyl)amino]-4-[4-[2-oxo-2-(propylamino)ethyl]piperazin-1-yl]benzoic acid |
| SMILES | CCCNC(=O)CN1CCN(c2ccc(C(=O)O)cc2NC(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C24H30N4O4/c1-3-10-25-22(29)16-27-11-13-28(14-12-27)21-9-8-19(24(31)32)15-20(21)26-23(30)18-6-4-17(2)5-7-18/h4-9,15H,3,10-14,16H2,1-2H3,(H,25,29)(H,26,30)(H,31,32) |
| InChIKey | OSFFQBGPKMQRND-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |