C25H32N4O5 — CID 46285388
4-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-3-[(4-methoxybenzoyl)amino]benzoic acid (PubChem CID 46285388) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-3-[(4-methoxybenzoyl)amino]benzoic acid.
| Compound Name | 4-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-3-[(4-methoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 46285388 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 4-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-3-[(4-methoxybenzoyl)amino]benzoic acid |
| SMILES | CCN(CC)C(=O)CN1CCN(c2ccc(C(=O)O)cc2NC(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C25H32N4O5/c1-4-28(5-2)23(30)17-27-12-14-29(15-13-27)22-11-8-19(25(32)33)16-21(22)26-24(31)18-6-9-20(34-3)10-7-18/h6-11,16H,4-5,12-15,17H2,1-3H3,(H,26,31)(H,32,33) |
| InChIKey | NQUJVLVXMIIHEU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |