C26H35N3O5 — CID 83283334
4-[4-[3-ethoxypropyl(methyl)amino]piperidin-1-yl]-3-[(4-methoxybenzoyl)amino]benzoic acid (PubChem CID 83283334) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is 4-[4-[3-ethoxypropyl(methyl)amino]piperidin-1-yl]-3-[(4-methoxybenzoyl)amino]benzoic acid.
| Compound Name | 4-[4-[3-ethoxypropyl(methyl)amino]piperidin-1-yl]-3-[(4-methoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 83283334 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 4-[4-[3-ethoxypropyl(methyl)amino]piperidin-1-yl]-3-[(4-methoxybenzoyl)amino]benzoic acid |
| SMILES | CCOCCCN(C)C1CCN(c2ccc(C(=O)O)cc2NC(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C26H35N3O5/c1-4-34-17-5-14-28(2)21-12-15-29(16-13-21)24-11-8-20(26(31)32)18-23(24)27-25(30)19-6-9-22(33-3)10-7-19/h6-11,18,21H,4-5,12-17H2,1-3H3,(H,27,30)(H,31,32) |
| InChIKey | FNINWUDZKUIKCZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|