C27H36F3N3O7S — CID 146056057
3-(benzenesulfonamido)-4-[4-[methyl(3-propan-2-yloxypropyl)amino]piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146056057) has the molecular formula C27H36F3N3O7S and a molecular weight of 603.66 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-4-[4-[methyl(3-propan-2-yloxypropyl)amino]piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(benzenesulfonamido)-4-[4-[methyl(3-propan-2-yloxypropyl)amino]piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146056057 |
| Molecular Formula | C27H36F3N3O7S |
| Molecular Weight | 603.66 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | 3-(benzenesulfonamido)-4-[4-[methyl(3-propan-2-yloxypropyl)amino]piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)OCCCN(C)C1CCN(c2ccc(C(=O)O)cc2NS(=O)(=O)c2ccccc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H35N3O5S.C2HF3O2/c1-19(2)33-17-7-14-27(3)21-12-15-28(16-13-21)24-11-10-20(25(29)30)18-23(24)26-34(31,32)22-8-5-4-6-9-22;3-2(4,5)1(6)7/h4-6,8-11,18-19,21,26H,7,12-17H2,1-3H3,(H,29,30);(H,6,7) |
| InChIKey | RDPKNXWDBHQIRY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|