C27H34F3N3O6 — CID 146071917
5-benzamido-2-[4-[3-ethoxypropyl(methyl)amino]piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146071917) has the molecular formula C27H34F3N3O6 and a molecular weight of 553.58 g/mol. Its IUPAC name is 5-benzamido-2-[4-[3-ethoxypropyl(methyl)amino]piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-benzamido-2-[4-[3-ethoxypropyl(methyl)amino]piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146071917 |
| Molecular Formula | C27H34F3N3O6 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 5-benzamido-2-[4-[3-ethoxypropyl(methyl)amino]piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCOCCCN(C)C1CCN(c2ccc(NC(=O)c3ccccc3)cc2C(=O)O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H33N3O4.C2HF3O2/c1-3-32-17-7-14-27(2)21-12-15-28(16-13-21)23-11-10-20(18-22(23)25(30)31)26-24(29)19-8-5-4-6-9-19;3-2(4,5)1(6)7/h4-6,8-11,18,21H,3,7,12-17H2,1-2H3,(H,26,29)(H,30,31);(H,6,7) |
| InChIKey | MGHBSRGMWIQPBK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|