C32H37F3N4O3 — CID 3605278
2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 3605278) has the molecular formula C32H37F3N4O3 and a molecular weight of 582.67 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 3605278 |
| Molecular Formula | C32H37F3N4O3 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-(3-ethoxypropyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)Nc2ccccc2C(F)(F)F)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H37F3N4O3/c1-2-42-20-8-17-36-30(40)26-22-25(37-31(41)38-28-12-7-6-11-27(28)32(33,34)35)13-14-29(26)39-18-15-24(16-19-39)21-23-9-4-3-5-10-23/h3-7,9-14,22,24H,2,8,15-21H2,1H3,(H,36,40)(H2,37,38,41) |
| InChIKey | WKUMDGWAECEBAQ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|