C30H36N4O4 — CID 3893161
2-(4-benzylpiperidin-1-yl)-N-(2-methoxyethyl)-5-[(2-methoxyphenyl)carbamoylamino]benzamide (PubChem CID 3893161) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-(2-methoxyethyl)-5-[(2-methoxyphenyl)carbamoylamino]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-(2-methoxyethyl)-5-[(2-methoxyphenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 3893161 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-(2-methoxyethyl)-5-[(2-methoxyphenyl)carbamoylamino]benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)Nc2ccccc2OC)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H36N4O4/c1-37-19-16-31-29(35)25-21-24(32-30(36)33-26-10-6-7-11-28(26)38-2)12-13-27(25)34-17-14-23(15-18-34)20-22-8-4-3-5-9-22/h3-13,21,23H,14-20H2,1-2H3,(H,31,35)(H2,32,33,36) |
| InChIKey | IMFXROITPXZNOI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|